C16H10BrFN2O3 — CID 141415197
2-(6-bromo-2,3-dioxoindol-1-yl)-N-(2-fluorophenyl)acetamide (PubChem CID 141415197) has the molecular formula C16H10BrFN2O3 and a molecular weight of 377.17 g/mol. Its IUPAC name is 2-(6-bromo-2,3-dioxoindol-1-yl)-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-(6-bromo-2,3-dioxoindol-1-yl)-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 141415197 |
| Molecular Formula | C16H10BrFN2O3 |
| Molecular Weight | 377.17 g/mol |
| Exact Mass | 375.99 |
| IUPAC Name | 2-(6-bromo-2,3-dioxoindol-1-yl)-N-(2-fluorophenyl)acetamide |
| SMILES | O=C(CN1C(=O)C(=O)c2ccc(Br)cc21)Nc1ccccc1F |
| InChI | InChI=1S/C16H10BrFN2O3/c17-9-5-6-10-13(7-9)20(16(23)15(10)22)8-14(21)19-12-4-2-1-3-11(12)18/h1-7H,8H2,(H,19,21) |
| InChIKey | KYFZFVCYDOHPMF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.17 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|