C11H10BrN3O4 — CID 66338418
hydrazinyl 3-(5-bromo-2,3-dioxoindol-1-yl)propanoate (PubChem CID 66338418) has the molecular formula C11H10BrN3O4 and a molecular weight of 328.12 g/mol. Its IUPAC name is hydrazinyl 3-(5-bromo-2,3-dioxoindol-1-yl)propanoate.
| Compound Name | hydrazinyl 3-(5-bromo-2,3-dioxoindol-1-yl)propanoate |
|---|---|
| PubChem CID | 66338418 |
| Molecular Formula | C11H10BrN3O4 |
| Molecular Weight | 328.12 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | hydrazinyl 3-(5-bromo-2,3-dioxoindol-1-yl)propanoate |
| SMILES | NNOC(=O)CCN1C(=O)C(=O)c2cc(Br)ccc21 |
| InChI | InChI=1S/C11H10BrN3O4/c12-6-1-2-8-7(5-6)10(17)11(18)15(8)4-3-9(16)19-14-13/h1-2,5,14H,3-4,13H2 |
| InChIKey | IVPMEZZSGXQQLX-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.12 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|