C16H19NO4 — CID 145328282
ethyl 3-(2,3-dioxo-5-propan-2-ylindol-1-yl)propanoate (PubChem CID 145328282) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is ethyl 3-(2,3-dioxo-5-propan-2-ylindol-1-yl)propanoate.
| Compound Name | ethyl 3-(2,3-dioxo-5-propan-2-ylindol-1-yl)propanoate |
|---|---|
| PubChem CID | 145328282 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | ethyl 3-(2,3-dioxo-5-propan-2-ylindol-1-yl)propanoate |
| SMILES | CCOC(=O)CCN1C(=O)C(=O)c2cc(C(C)C)ccc21 |
| InChI | InChI=1S/C16H19NO4/c1-4-21-14(18)7-8-17-13-6-5-11(10(2)3)9-12(13)15(19)16(17)20/h5-6,9-10H,4,7-8H2,1-3H3 |
| InChIKey | MCBHDFYEMAVJBX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|