C15H11NO5 — CID 62023854
1-[2-(furan-2-yl)-2-oxoethyl]-5-methoxyindole-2,3-dione (PubChem CID 62023854) has the molecular formula C15H11NO5 and a molecular weight of 285.25 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)-2-oxoethyl]-5-methoxyindole-2,3-dione.
| Compound Name | 1-[2-(furan-2-yl)-2-oxoethyl]-5-methoxyindole-2,3-dione |
|---|---|
| PubChem CID | 62023854 |
| Molecular Formula | C15H11NO5 |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 1-[2-(furan-2-yl)-2-oxoethyl]-5-methoxyindole-2,3-dione |
| SMILES | COc1ccc2c(c1)C(=O)C(=O)N2CC(=O)c1ccco1 |
| InChI | InChI=1S/C15H11NO5/c1-20-9-4-5-11-10(7-9)14(18)15(19)16(11)8-12(17)13-3-2-6-21-13/h2-7H,8H2,1H3 |
| InChIKey | XUMOZNRXZTUDCS-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|