C10H8BF3NO3- — CID 63702848
trifluoro-[(5-methoxy-2,3-dioxoindol-1-yl)methyl]boranuide (PubChem CID 63702848) has the molecular formula C10H8BF3NO3- and a molecular weight of 257.98 g/mol. Its IUPAC name is trifluoro-[(5-methoxy-2,3-dioxoindol-1-yl)methyl]boranuide.
| Compound Name | trifluoro-[(5-methoxy-2,3-dioxoindol-1-yl)methyl]boranuide |
|---|---|
| PubChem CID | 63702848 |
| Molecular Formula | C10H8BF3NO3- |
| Molecular Weight | 257.98 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | trifluoro-[(5-methoxy-2,3-dioxoindol-1-yl)methyl]boranuide |
| SMILES | COc1ccc2c(c1)C(=O)C(=O)N2C[B-](F)(F)F |
| InChI | InChI=1S/C10H8BF3NO3/c1-18-6-2-3-8-7(4-6)9(16)10(17)15(8)5-11(12,13)14/h2-4H,5H2,1H3/q-1 |
| InChIKey | UFUIPGCJOADHPM-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.98 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|