C9H5BF4NO2- — CID 63705188
trifluoro-[(5-fluoro-2,3-dioxoindol-1-yl)methyl]boranuide (PubChem CID 63705188) has the molecular formula C9H5BF4NO2- and a molecular weight of 245.95 g/mol. Its IUPAC name is trifluoro-[(5-fluoro-2,3-dioxoindol-1-yl)methyl]boranuide.
| Compound Name | trifluoro-[(5-fluoro-2,3-dioxoindol-1-yl)methyl]boranuide |
|---|---|
| PubChem CID | 63705188 |
| Molecular Formula | C9H5BF4NO2- |
| Molecular Weight | 245.95 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | trifluoro-[(5-fluoro-2,3-dioxoindol-1-yl)methyl]boranuide |
| SMILES | O=C1C(=O)N(C[B-](F)(F)F)c2ccc(F)cc21 |
| InChI | InChI=1S/C9H5BF4NO2/c11-5-1-2-7-6(3-5)8(16)9(17)15(7)4-10(12,13)14/h1-3H,4H2/q-1 |
| InChIKey | MIUQBIJOIWOELR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.95 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|