C13H12FNO3 — CID 79395662
5-fluoro-1-(3-methyl-2-oxobutyl)indole-2,3-dione (PubChem CID 79395662) has the molecular formula C13H12FNO3 and a molecular weight of 249.24 g/mol. Its IUPAC name is 5-fluoro-1-(3-methyl-2-oxobutyl)indole-2,3-dione.
| Compound Name | 5-fluoro-1-(3-methyl-2-oxobutyl)indole-2,3-dione |
|---|---|
| PubChem CID | 79395662 |
| Molecular Formula | C13H12FNO3 |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 5-fluoro-1-(3-methyl-2-oxobutyl)indole-2,3-dione |
| SMILES | CC(C)C(=O)CN1C(=O)C(=O)c2cc(F)ccc21 |
| InChI | InChI=1S/C13H12FNO3/c1-7(2)11(16)6-15-10-4-3-8(14)5-9(10)12(17)13(15)18/h3-5,7H,6H2,1-2H3 |
| InChIKey | DDQNMLOGIISNOY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|