C14H15FN2O4 — CID 61487935
2-(6-fluoro-2,3-dioxoindol-1-yl)-N-(1-methoxypropan-2-yl)acetamide (PubChem CID 61487935) has the molecular formula C14H15FN2O4 and a molecular weight of 294.28 g/mol. Its IUPAC name is 2-(6-fluoro-2,3-dioxoindol-1-yl)-N-(1-methoxypropan-2-yl)acetamide.
| Compound Name | 2-(6-fluoro-2,3-dioxoindol-1-yl)-N-(1-methoxypropan-2-yl)acetamide |
|---|---|
| PubChem CID | 61487935 |
| Molecular Formula | C14H15FN2O4 |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-(6-fluoro-2,3-dioxoindol-1-yl)-N-(1-methoxypropan-2-yl)acetamide |
| SMILES | COCC(C)NC(=O)CN1C(=O)C(=O)c2ccc(F)cc21 |
| InChI | InChI=1S/C14H15FN2O4/c1-8(7-21-2)16-12(18)6-17-11-5-9(15)3-4-10(11)13(19)14(17)20/h3-5,8H,6-7H2,1-2H3,(H,16,18) |
| InChIKey | FXRGYRHKRFZQAQ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|