C16H16FNO3 — CID 104751180
1-(2-cyclohexyl-2-oxoethyl)-6-fluoroindole-2,3-dione (PubChem CID 104751180) has the molecular formula C16H16FNO3 and a molecular weight of 289.31 g/mol. Its IUPAC name is 1-(2-cyclohexyl-2-oxoethyl)-6-fluoroindole-2,3-dione.
| Compound Name | 1-(2-cyclohexyl-2-oxoethyl)-6-fluoroindole-2,3-dione |
|---|---|
| PubChem CID | 104751180 |
| Molecular Formula | C16H16FNO3 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 1-(2-cyclohexyl-2-oxoethyl)-6-fluoroindole-2,3-dione |
| SMILES | O=C1C(=O)N(CC(=O)C2CCCCC2)c2cc(F)ccc21 |
| InChI | InChI=1S/C16H16FNO3/c17-11-6-7-12-13(8-11)18(16(21)15(12)20)9-14(19)10-4-2-1-3-5-10/h6-8,10H,1-5,9H2 |
| InChIKey | CRKARSWBJZLRTJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|