C21H18N2O5 — CID 7804451
[(2S)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 2-(2,3-dioxoindol-1-yl)acetate (PubChem CID 7804451) has the molecular formula C21H18N2O5 and a molecular weight of 378.38 g/mol. Its IUPAC name is [(2S)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 2-(2,3-dioxoindol-1-yl)acetate.
| Compound Name | [(2S)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 2-(2,3-dioxoindol-1-yl)acetate |
|---|---|
| PubChem CID | 7804451 |
| Molecular Formula | C21H18N2O5 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | [(2S)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 2-(2,3-dioxoindol-1-yl)acetate |
| SMILES | C[C@H](OC(=O)CN1C(=O)C(=O)c2ccccc21)C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C21H18N2O5/c1-13(20(26)22-11-10-14-6-2-4-8-16(14)22)28-18(24)12-23-17-9-5-3-7-15(17)19(25)21(23)27/h2-9,13H,10-12H2,1H3/t13-/m0/s1 |
| InChIKey | DBQZYSVJJNXGLR-ZDUSSCGKSA-N |
| XLogP | 1.74 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|