C22H20N2O5 — CID 8926596
[(2R)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 8926596) has the molecular formula C22H20N2O5 and a molecular weight of 392.41 g/mol. Its IUPAC name is [(2R)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [(2R)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 8926596 |
| Molecular Formula | C22H20N2O5 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | [(2R)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | C[C@@H](OC(=O)[C@H](C)N1C(=O)c2ccccc2C1=O)C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C22H20N2O5/c1-13(24-20(26)16-8-4-5-9-17(16)21(24)27)22(28)29-14(2)19(25)23-12-11-15-7-3-6-10-18(15)23/h3-10,13-14H,11-12H2,1-2H3/t13-,14+/m0/s1 |
| InChIKey | IORWEXVGURRSFO-UONOGXRCSA-N |
| XLogP | 2.19 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|