C21H19N3O6 — CID 8576727
[(2R)-1-(benzylcarbamoylamino)-1-oxopropan-2-yl] 2-(2,3-dioxoindol-1-yl)acetate (PubChem CID 8576727) has the molecular formula C21H19N3O6 and a molecular weight of 409.40 g/mol. Its IUPAC name is [(2R)-1-(benzylcarbamoylamino)-1-oxopropan-2-yl] 2-(2,3-dioxoindol-1-yl)acetate.
| Compound Name | [(2R)-1-(benzylcarbamoylamino)-1-oxopropan-2-yl] 2-(2,3-dioxoindol-1-yl)acetate |
|---|---|
| PubChem CID | 8576727 |
| Molecular Formula | C21H19N3O6 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | [(2R)-1-(benzylcarbamoylamino)-1-oxopropan-2-yl] 2-(2,3-dioxoindol-1-yl)acetate |
| SMILES | C[C@@H](OC(=O)CN1C(=O)C(=O)c2ccccc21)C(=O)NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C21H19N3O6/c1-13(19(27)23-21(29)22-11-14-7-3-2-4-8-14)30-17(25)12-24-16-10-6-5-9-15(16)18(26)20(24)28/h2-10,13H,11-12H2,1H3,(H2,22,23,27,29)/t13-/m1/s1 |
| InChIKey | KVZCWQHPGALANN-CYBMUJFWSA-N |
| XLogP | 1.17 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|