C21H18N2O7 — CID 7804415
[(2S)-1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] 2-(2,3-dioxoindol-1-yl)acetate (PubChem CID 7804415) has the molecular formula C21H18N2O7 and a molecular weight of 410.38 g/mol. Its IUPAC name is [(2S)-1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] 2-(2,3-dioxoindol-1-yl)acetate.
| Compound Name | [(2S)-1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] 2-(2,3-dioxoindol-1-yl)acetate |
|---|---|
| PubChem CID | 7804415 |
| Molecular Formula | C21H18N2O7 |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | [(2S)-1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] 2-(2,3-dioxoindol-1-yl)acetate |
| SMILES | C[C@H](OC(=O)CN1C(=O)C(=O)c2ccccc21)C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H18N2O7/c1-12(20(26)22-9-13-6-7-16-17(8-13)29-11-28-16)30-18(24)10-23-15-5-3-2-4-14(15)19(25)21(23)27/h2-8,12H,9-11H2,1H3,(H,22,26)/t12-/m0/s1 |
| InChIKey | GPYBZDMMYHFQRV-LBPRGKRZSA-N |
| XLogP | 1.19 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|