C26H20N2O7 — CID 2598468
[(2S)-1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] 4-(1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 2598468) has the molecular formula C26H20N2O7 and a molecular weight of 472.45 g/mol. Its IUPAC name is [(2S)-1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] 4-(1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | [(2S)-1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] 4-(1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 2598468 |
| Molecular Formula | C26H20N2O7 |
| Molecular Weight | 472.45 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | [(2S)-1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] 4-(1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | C[C@H](OC(=O)c1ccc(N2C(=O)c3ccccc3C2=O)cc1)C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C26H20N2O7/c1-15(23(29)27-13-16-6-11-21-22(12-16)34-14-33-21)35-26(32)17-7-9-18(10-8-17)28-24(30)19-4-2-3-5-20(19)25(28)31/h2-12,15H,13-14H2,1H3,(H,27,29)/t15-/m0/s1 |
| InChIKey | UFJQOUKNZIAIRI-HNNXBMFYSA-N |
| XLogP | 3.08 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.45 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|