C24H24N2O5 — CID 7274980
[(2R)-1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] 4-(2,5-dimethylpyrrol-1-yl)benzoate (PubChem CID 7274980) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is [(2R)-1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] 4-(2,5-dimethylpyrrol-1-yl)benzoate.
| Compound Name | [(2R)-1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] 4-(2,5-dimethylpyrrol-1-yl)benzoate |
|---|---|
| PubChem CID | 7274980 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | [(2R)-1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] 4-(2,5-dimethylpyrrol-1-yl)benzoate |
| SMILES | Cc1ccc(C)n1-c1ccc(C(=O)O[C@H](C)C(=O)NCc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C24H24N2O5/c1-15-4-5-16(2)26(15)20-9-7-19(8-10-20)24(28)31-17(3)23(27)25-13-18-6-11-21-22(12-18)30-14-29-21/h4-12,17H,13-14H2,1-3H3,(H,25,27)/t17-/m1/s1 |
| InChIKey | ZXPMWAQKQFGHOE-QGZVFWFLSA-N |
| XLogP | 3.68 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|