About 3-iminoisoindol-1-amine
3-iminoisoindol-1-amine (PubChem CID 139180243) has the molecular formula C16H14N6
and a molecular weight of 290.33 g/mol. Its IUPAC name is 3-iminoisoindol-1-amine.
Molecular Properties
| Compound Name | 3-iminoisoindol-1-amine |
| PubChem CID | 139180243 |
| Molecular Formula | C16H14N6 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 3-iminoisoindol-1-amine |
| SMILES | [H]/N=C1\N=C(N)c2ccccc21.[H]/N=C1\N=C(N)c2ccccc21 |
| InChI | InChI=1S/2C8H7N3/c2*9-7-5-3-1-2-4-6(5)8(10)11-7/h2*1-4H,(H3,9,10,11) |
| InChIKey | UIOAOMOPAALPLQ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 124.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-iminoisoindol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iminoisoindol-1-amine?
The IUPAC name of 3-iminoisoindol-1-amine (CID 139180243) is 3-iminoisoindol-1-amine.
What is the SMILES notation for 3-iminoisoindol-1-amine?
The canonical SMILES for 3-iminoisoindol-1-amine is [H]/N=C1\N=C(N)c2ccccc21.[H]/N=C1\N=C(N)c2ccccc21.
What is the InChIKey of 3-iminoisoindol-1-amine?
The InChIKey is UIOAOMOPAALPLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H7N3/c2*9-7-5-3-1-2-4-6(5)8(10)11-7/h2*1-4H,(H3,9,10,11).
What are the key properties of 3-iminoisoindol-1-amine?
3-iminoisoindol-1-amine has a molecular weight of 290.33 g/mol, XLogP of 1.46, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iminoisoindol-1-amine is sourced from PubChem (CID 139180243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).