C13H10O8 — CID 146550128
(2,3,4,6-tetrahydroxyphenyl)-(2,4,6-trihydroxyphenyl)methanone (PubChem CID 146550128) has the molecular formula C13H10O8 and a molecular weight of 294.21 g/mol. Its IUPAC name is (2,3,4,6-tetrahydroxyphenyl)-(2,4,6-trihydroxyphenyl)methanone.
| Compound Name | (2,3,4,6-tetrahydroxyphenyl)-(2,4,6-trihydroxyphenyl)methanone |
|---|---|
| PubChem CID | 146550128 |
| Molecular Formula | C13H10O8 |
| Molecular Weight | 294.21 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | (2,3,4,6-tetrahydroxyphenyl)-(2,4,6-trihydroxyphenyl)methanone |
| SMILES | O=C(c1c(O)cc(O)cc1O)c1c(O)cc(O)c(O)c1O |
| InChI | InChI=1S/C13H10O8/c14-4-1-5(15)9(6(16)2-4)12(20)10-7(17)3-8(18)11(19)13(10)21/h1-3,14-19,21H |
| InChIKey | FVLSBMWQLMMQSO-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 158.68 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.21 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|