C15H14O7 — CID 156637989
1,3-bis(2,4,6-trihydroxyphenyl)propan-2-one (PubChem CID 156637989) has the molecular formula C15H14O7 and a molecular weight of 306.27 g/mol. Its IUPAC name is 1,3-bis(2,4,6-trihydroxyphenyl)propan-2-one.
| Compound Name | 1,3-bis(2,4,6-trihydroxyphenyl)propan-2-one |
|---|---|
| PubChem CID | 156637989 |
| Molecular Formula | C15H14O7 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 1,3-bis(2,4,6-trihydroxyphenyl)propan-2-one |
| SMILES | O=C(Cc1c(O)cc(O)cc1O)Cc1c(O)cc(O)cc1O |
| InChI | InChI=1S/C15H14O7/c16-7(1-10-12(19)3-8(17)4-13(10)20)2-11-14(21)5-9(18)6-15(11)22/h3-6,17-22H,1-2H2 |
| InChIKey | KZRTVWBDTKXCQC-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |