C14H14O4 — CID 163472366
2-[2-(4-hydroxyphenyl)ethyl]benzene-1,3,5-triol (PubChem CID 163472366) has the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. Its IUPAC name is 2-[2-(4-hydroxyphenyl)ethyl]benzene-1,3,5-triol.
| Compound Name | 2-[2-(4-hydroxyphenyl)ethyl]benzene-1,3,5-triol |
|---|---|
| PubChem CID | 163472366 |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 2-[2-(4-hydroxyphenyl)ethyl]benzene-1,3,5-triol |
| SMILES | Oc1ccc(CCc2c(O)cc(O)cc2O)cc1 |
| InChI | InChI=1S/C14H14O4/c15-10-4-1-9(2-5-10)3-6-12-13(17)7-11(16)8-14(12)18/h1-2,4-5,7-8,15-18H,3,6H2 |
| InChIKey | BXOOUHBFMRHRCD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |