C15H14Br2O4 — CID 118565985
5-(bromomethyl)-4-[[2-(bromomethyl)-4,6-dihydroxyphenyl]methyl]benzene-1,3-diol (PubChem CID 118565985) has the molecular formula C15H14Br2O4 and a molecular weight of 418.08 g/mol. Its IUPAC name is 5-(bromomethyl)-4-[[2-(bromomethyl)-4,6-dihydroxyphenyl]methyl]benzene-1,3-diol.
| Compound Name | 5-(bromomethyl)-4-[[2-(bromomethyl)-4,6-dihydroxyphenyl]methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 118565985 |
| Molecular Formula | C15H14Br2O4 |
| Molecular Weight | 418.08 g/mol |
| Exact Mass | 415.93 |
| IUPAC Name | 5-(bromomethyl)-4-[[2-(bromomethyl)-4,6-dihydroxyphenyl]methyl]benzene-1,3-diol |
| SMILES | Oc1cc(O)c(Cc2c(O)cc(O)cc2CBr)c(CBr)c1 |
| InChI | InChI=1S/C15H14Br2O4/c16-6-8-1-10(18)3-14(20)12(8)5-13-9(7-17)2-11(19)4-15(13)21/h1-4,18-21H,5-7H2 |
| InChIKey | FVYGEMHOXCQZAM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.08 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|