C49H40O12 — CID 139492113
1-[[4,5-bis[(3,4-dihydroxyphenyl)methyl]-2,7-dihydroxynaphthalen-1-yl]methyl]-4,5-bis[(3,4-dihydroxyphenyl)methyl]naphthalene-2,7-diol (PubChem CID 139492113) has the molecular formula C49H40O12 and a molecular weight of 820.85 g/mol. Its IUPAC name is 1-[[4,5-bis[(3,4-dihydroxyphenyl)methyl]-2,7-dihydroxynaphthalen-1-yl]methyl]-4,5-bis[(3,4-dihydroxyphenyl)methyl]naphthalene-2,7-diol.
| Compound Name | 1-[[4,5-bis[(3,4-dihydroxyphenyl)methyl]-2,7-dihydroxynaphthalen-1-yl]methyl]-4,5-bis[(3,4-dihydroxyphenyl)methyl]naphthalene-2,7-diol |
|---|---|
| PubChem CID | 139492113 |
| Molecular Formula | C49H40O12 |
| Molecular Weight | 820.85 g/mol |
| Exact Mass | 820.25 |
| IUPAC Name | 1-[[4,5-bis[(3,4-dihydroxyphenyl)methyl]-2,7-dihydroxynaphthalen-1-yl]methyl]-4,5-bis[(3,4-dihydroxyphenyl)methyl]naphthalene-2,7-diol |
| SMILES | Oc1cc(Cc2ccc(O)c(O)c2)c2c(Cc3ccc(O)c(O)c3)cc(O)c(Cc3c(O)cc(Cc4ccc(O)c(O)c4)c4c(Cc5ccc(O)c(O)c5)cc(O)cc34)c2c1 |
| InChI | InChI=1S/C49H40O12/c50-32-17-28(9-24-1-5-38(52)44(58)13-24)48-30(11-26-3-7-40(54)46(60)15-26)19-42(56)34(36(48)21-32)23-35-37-22-33(51)18-29(10-25-2-6-39(53)45(59)14-25)49(37)31(20-43(35)57)12-27-4-8-41(55)47(61)16-27/h1-8,13-22,50-61H,9-12,23H2 |
| InChIKey | LXSRRHFIEPBDPU-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 242.76 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 61 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.85 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|