C38H32O10 — CID 139492095
2,4,6,8-tetrakis[(3,4-dihydroxyphenyl)methyl]naphthalene-1,5-diol (PubChem CID 139492095) has the molecular formula C38H32O10 and a molecular weight of 648.66 g/mol. Its IUPAC name is 2,4,6,8-tetrakis[(3,4-dihydroxyphenyl)methyl]naphthalene-1,5-diol.
| Compound Name | 2,4,6,8-tetrakis[(3,4-dihydroxyphenyl)methyl]naphthalene-1,5-diol |
|---|---|
| PubChem CID | 139492095 |
| Molecular Formula | C38H32O10 |
| Molecular Weight | 648.66 g/mol |
| Exact Mass | 648.20 |
| IUPAC Name | 2,4,6,8-tetrakis[(3,4-dihydroxyphenyl)methyl]naphthalene-1,5-diol |
| SMILES | Oc1ccc(Cc2cc(Cc3ccc(O)c(O)c3)c3c(O)c(Cc4ccc(O)c(O)c4)cc(Cc4ccc(O)c(O)c4)c3c2O)cc1O |
| InChI | InChI=1S/C38H32O10/c39-27-5-1-19(13-31(27)43)9-23-17-25(11-21-3-7-29(41)33(45)15-21)38(48)36-24(10-20-2-6-28(40)32(44)14-20)18-26(37(47)35(23)36)12-22-4-8-30(42)34(46)16-22/h1-8,13-18,39-48H,9-12H2 |
| InChIKey | CEEVCHQTOZXXBB-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 202.30 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.66 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|