C22H22O6 — CID 172870403
4,6-bis[2-(3,4-dihydroxyphenyl)ethyl]benzene-1,3-diol (PubChem CID 172870403) has the molecular formula C22H22O6 and a molecular weight of 382.41 g/mol. Its IUPAC name is 4,6-bis[2-(3,4-dihydroxyphenyl)ethyl]benzene-1,3-diol.
| Compound Name | 4,6-bis[2-(3,4-dihydroxyphenyl)ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 172870403 |
| Molecular Formula | C22H22O6 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 4,6-bis[2-(3,4-dihydroxyphenyl)ethyl]benzene-1,3-diol |
| SMILES | Oc1ccc(CCc2cc(CCc3ccc(O)c(O)c3)c(O)cc2O)cc1O |
| InChI | InChI=1S/C22H22O6/c23-17-7-3-13(9-21(17)27)1-5-15-11-16(20(26)12-19(15)25)6-2-14-4-8-18(24)22(28)10-14/h3-4,7-12,23-28H,1-2,5-6H2 |
| InChIKey | BHDWPJUPXSZMQY-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|