C8H12ClNO2 — CID 90477542
4-(2-amino-2,2-dideuterioethyl)benzene-1,2-diol;hydrochloride (PubChem CID 90477542) has the molecular formula C8H12ClNO2 and a molecular weight of 191.65 g/mol. Its IUPAC name is 4-(2-amino-2,2-dideuterioethyl)benzene-1,2-diol;hydrochloride.
| Compound Name | 4-(2-amino-2,2-dideuterioethyl)benzene-1,2-diol;hydrochloride |
|---|---|
| PubChem CID | 90477542 |
| Molecular Formula | C8H12ClNO2 |
| Molecular Weight | 191.65 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 4-(2-amino-2,2-dideuterioethyl)benzene-1,2-diol;hydrochloride |
| SMILES | Cl.[2H]C([2H])(N)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C8H11NO2.ClH/c9-4-3-6-1-2-7(10)8(11)5-6;/h1-2,5,10-11H,3-4,9H2;1H/i4D2; |
| InChIKey | CTENFNNZBMHDDG-YLENYTFQSA-N |
| XLogP | 1.02 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.65 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|