About 4-(2-aminoethyl)benzene-1,2-diol;piperazine
4-(2-aminoethyl)benzene-1,2-diol;piperazine (PubChem CID 174812852) has the molecular formula C12H21N3O2
and a molecular weight of 239.32 g/mol. Its IUPAC name is 4-(2-aminoethyl)benzene-1,2-diol;piperazine.
Molecular Properties
| Compound Name | 4-(2-aminoethyl)benzene-1,2-diol;piperazine |
| PubChem CID | 174812852 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | 4-(2-aminoethyl)benzene-1,2-diol;piperazine |
| SMILES | C1CNCCN1.NCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C8H11NO2.C4H10N2/c9-4-3-6-1-2-7(10)8(11)5-6;1-2-6-4-3-5-1/h1-2,5,10-11H,3-4,9H2;5-6H,1-4H2 |
| InChIKey | HECQEKITMJBCCC-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-aminoethyl)benzene-1,2-diol;piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminoethyl)benzene-1,2-diol;piperazine?
The IUPAC name of 4-(2-aminoethyl)benzene-1,2-diol;piperazine (CID 174812852) is 4-(2-aminoethyl)benzene-1,2-diol;piperazine.
What is the SMILES notation for 4-(2-aminoethyl)benzene-1,2-diol;piperazine?
The canonical SMILES for 4-(2-aminoethyl)benzene-1,2-diol;piperazine is C1CNCCN1.NCCc1ccc(O)c(O)c1.
What is the InChIKey of 4-(2-aminoethyl)benzene-1,2-diol;piperazine?
The InChIKey is HECQEKITMJBCCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2.C4H10N2/c9-4-3-6-1-2-7(10)8(11)5-6;1-2-6-4-3-5-1/h1-2,5,10-11H,3-4,9H2;5-6H,1-4H2.
What are the key properties of 4-(2-aminoethyl)benzene-1,2-diol;piperazine?
4-(2-aminoethyl)benzene-1,2-diol;piperazine has a molecular weight of 239.32 g/mol, XLogP of -0.22, 2 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminoethyl)benzene-1,2-diol;piperazine is sourced from PubChem (CID 174812852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).