C18H22N2O4 — CID 160840922
4-(2-aminoethyl)benzene-1,2-diol;4,7-dimethyl-1H-indole-5,6-diol (PubChem CID 160840922) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 4-(2-aminoethyl)benzene-1,2-diol;4,7-dimethyl-1H-indole-5,6-diol.
| Compound Name | 4-(2-aminoethyl)benzene-1,2-diol;4,7-dimethyl-1H-indole-5,6-diol |
|---|---|
| PubChem CID | 160840922 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 4-(2-aminoethyl)benzene-1,2-diol;4,7-dimethyl-1H-indole-5,6-diol |
| SMILES | Cc1c(O)c(O)c(C)c2[nH]ccc12.NCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C10H11NO2.C8H11NO2/c1-5-7-3-4-11-8(7)6(2)10(13)9(5)12;9-4-3-6-1-2-7(10)8(11)5-6/h3-4,11-13H,1-2H3;1-2,5,10-11H,3-4,9H2 |
| InChIKey | SIACBGMTFZVJNT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 122.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|