C13H21NO6 — CID 174886468
4-(2-aminoethyl)benzene-1,2-diol;ethane-1,2-diol;prop-2-enoic acid (PubChem CID 174886468) has the molecular formula C13H21NO6 and a molecular weight of 287.31 g/mol. Its IUPAC name is 4-(2-aminoethyl)benzene-1,2-diol;ethane-1,2-diol;prop-2-enoic acid.
| Compound Name | 4-(2-aminoethyl)benzene-1,2-diol;ethane-1,2-diol;prop-2-enoic acid |
|---|---|
| PubChem CID | 174886468 |
| Molecular Formula | C13H21NO6 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 4-(2-aminoethyl)benzene-1,2-diol;ethane-1,2-diol;prop-2-enoic acid |
| SMILES | C=CC(=O)O.NCCc1ccc(O)c(O)c1.OCCO |
| InChI | InChI=1S/C8H11NO2.C3H4O2.C2H6O2/c9-4-3-6-1-2-7(10)8(11)5-6;1-2-3(4)5;3-1-2-4/h1-2,5,10-11H,3-4,9H2;2H,1H2,(H,4,5);3-4H,1-2H2 |
| InChIKey | CCVIVPQZVGLNGA-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|