C11H15NO4 — CID 87632824
(3S)-2-amino-2,3-dideuterio-5-(3,4-dihydroxyphenyl)pentanoic acid (PubChem CID 87632824) has the molecular formula C11H15NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is (3S)-2-amino-2,3-dideuterio-5-(3,4-dihydroxyphenyl)pentanoic acid.
| Compound Name | (3S)-2-amino-2,3-dideuterio-5-(3,4-dihydroxyphenyl)pentanoic acid |
|---|---|
| PubChem CID | 87632824 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | (3S)-2-amino-2,3-dideuterio-5-(3,4-dihydroxyphenyl)pentanoic acid |
| SMILES | [2H][C@@H](CCc1ccc(O)c(O)c1)C([2H])(N)C(=O)O |
| InChI | InChI=1S/C11H15NO4/c12-8(11(15)16)3-1-2-7-4-5-9(13)10(14)6-7/h4-6,8,13-14H,1-3,12H2,(H,15,16)/i3D,8D/t3-,8?/m0/s1 |
| InChIKey | PMMNPSZBLROCSD-QUPSQXPYSA-N |
| XLogP | 0.83 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|