C10H13NO4 — CID 118599343
2-amino-2,3-dideuterio-4-(3,4-dihydroxyphenyl)butanoic acid (PubChem CID 118599343) has the molecular formula C10H13NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is 2-amino-2,3-dideuterio-4-(3,4-dihydroxyphenyl)butanoic acid.
| Compound Name | 2-amino-2,3-dideuterio-4-(3,4-dihydroxyphenyl)butanoic acid |
|---|---|
| PubChem CID | 118599343 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 2-amino-2,3-dideuterio-4-(3,4-dihydroxyphenyl)butanoic acid |
| SMILES | [2H]C(Cc1ccc(O)c(O)c1)C([2H])(N)C(=O)O |
| InChI | InChI=1S/C10H13NO4/c11-7(10(14)15)3-1-6-2-4-8(12)9(13)5-6/h2,4-5,7,12-13H,1,3,11H2,(H,14,15)/i3D,7D |
| InChIKey | WIGIYFSINYQGJT-MKANTAFVSA-N |
| XLogP | 0.44 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|