C14H22O3 — CID 22165808
2-(6-methylheptyl)benzene-1,3,5-triol (PubChem CID 22165808) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is 2-(6-methylheptyl)benzene-1,3,5-triol.
| Compound Name | 2-(6-methylheptyl)benzene-1,3,5-triol |
|---|---|
| PubChem CID | 22165808 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | 2-(6-methylheptyl)benzene-1,3,5-triol |
| SMILES | CC(C)CCCCCc1c(O)cc(O)cc1O |
| InChI | InChI=1S/C14H22O3/c1-10(2)6-4-3-5-7-12-13(16)8-11(15)9-14(12)17/h8-10,15-17H,3-7H2,1-2H3 |
| InChIKey | DGINNVRIANOVFU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|