C7H6BrFO2 — CID 156868769
5-(bromomethyl)-4-fluorobenzene-1,3-diol (PubChem CID 156868769) has the molecular formula C7H6BrFO2 and a molecular weight of 221.02 g/mol. Its IUPAC name is 5-(bromomethyl)-4-fluorobenzene-1,3-diol.
| Compound Name | 5-(bromomethyl)-4-fluorobenzene-1,3-diol |
|---|---|
| PubChem CID | 156868769 |
| Molecular Formula | C7H6BrFO2 |
| Molecular Weight | 221.02 g/mol |
| Exact Mass | 219.95 |
| IUPAC Name | 5-(bromomethyl)-4-fluorobenzene-1,3-diol |
| SMILES | Oc1cc(O)c(F)c(CBr)c1 |
| InChI | InChI=1S/C7H6BrFO2/c8-3-4-1-5(10)2-6(11)7(4)9/h1-2,10-11H,3H2 |
| InChIKey | PABMSCODCMFXRV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.02 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|