C9H5BrF6O — CID 118851209
2-(bromomethyl)-4,5-bis(trifluoromethyl)phenol (PubChem CID 118851209) has the molecular formula C9H5BrF6O and a molecular weight of 323.03 g/mol. Its IUPAC name is 2-(bromomethyl)-4,5-bis(trifluoromethyl)phenol.
| Compound Name | 2-(bromomethyl)-4,5-bis(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 118851209 |
| Molecular Formula | C9H5BrF6O |
| Molecular Weight | 323.03 g/mol |
| Exact Mass | 321.94 |
| IUPAC Name | 2-(bromomethyl)-4,5-bis(trifluoromethyl)phenol |
| SMILES | Oc1cc(C(F)(F)F)c(C(F)(F)F)cc1CBr |
| InChI | InChI=1S/C9H5BrF6O/c10-3-4-1-5(8(11,12)13)6(2-7(4)17)9(14,15)16/h1-2,17H,3H2 |
| InChIKey | MSNZQDQBANBUFR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.03 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|