C9H4BrF6I — CID 134638408
1-(bromomethyl)-2-iodo-4,5-bis(trifluoromethyl)benzene (PubChem CID 134638408) has the molecular formula C9H4BrF6I and a molecular weight of 432.93 g/mol. Its IUPAC name is 1-(bromomethyl)-2-iodo-4,5-bis(trifluoromethyl)benzene.
| Compound Name | 1-(bromomethyl)-2-iodo-4,5-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 134638408 |
| Molecular Formula | C9H4BrF6I |
| Molecular Weight | 432.93 g/mol |
| Exact Mass | 431.84 |
| IUPAC Name | 1-(bromomethyl)-2-iodo-4,5-bis(trifluoromethyl)benzene |
| SMILES | FC(F)(F)c1cc(I)c(CBr)cc1C(F)(F)F |
| InChI | InChI=1S/C9H4BrF6I/c10-3-4-1-5(8(11,12)13)6(2-7(4)17)9(14,15)16/h1-2H,3H2 |
| InChIKey | QWRPEYCKEVWELK-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.93 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|