C8H4BrCl2F3 — CID 171015138
1-(bromomethyl)-4,5-dichloro-2-(trifluoromethyl)benzene (PubChem CID 171015138) has the molecular formula C8H4BrCl2F3 and a molecular weight of 307.92 g/mol. Its IUPAC name is 1-(bromomethyl)-4,5-dichloro-2-(trifluoromethyl)benzene.
| Compound Name | 1-(bromomethyl)-4,5-dichloro-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 171015138 |
| Molecular Formula | C8H4BrCl2F3 |
| Molecular Weight | 307.92 g/mol |
| Exact Mass | 305.88 |
| IUPAC Name | 1-(bromomethyl)-4,5-dichloro-2-(trifluoromethyl)benzene |
| SMILES | FC(F)(F)c1cc(Cl)c(Cl)cc1CBr |
| InChI | InChI=1S/C8H4BrCl2F3/c9-3-4-1-6(10)7(11)2-5(4)8(12,13)14/h1-2H,3H2 |
| InChIKey | KGYFFJJUMYDWBS-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.92 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|