C10H7BrF6 — CID 135743210
1-(bromomethyl)-2-methyl-4,5-bis(trifluoromethyl)benzene (PubChem CID 135743210) has the molecular formula C10H7BrF6 and a molecular weight of 321.06 g/mol. Its IUPAC name is 1-(bromomethyl)-2-methyl-4,5-bis(trifluoromethyl)benzene.
| Compound Name | 1-(bromomethyl)-2-methyl-4,5-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 135743210 |
| Molecular Formula | C10H7BrF6 |
| Molecular Weight | 321.06 g/mol |
| Exact Mass | 319.96 |
| IUPAC Name | 1-(bromomethyl)-2-methyl-4,5-bis(trifluoromethyl)benzene |
| SMILES | Cc1cc(C(F)(F)F)c(C(F)(F)F)cc1CBr |
| InChI | InChI=1S/C10H7BrF6/c1-5-2-7(9(12,13)14)8(10(15,16)17)3-6(5)4-11/h2-3H,4H2,1H3 |
| InChIKey | NHQBQWYHJXEYMG-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.06 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|