C10H8F6O — CID 135742857
4-ethyl-2,5-bis(trifluoromethyl)phenol (PubChem CID 135742857) has the molecular formula C10H8F6O and a molecular weight of 258.16 g/mol. Its IUPAC name is 4-ethyl-2,5-bis(trifluoromethyl)phenol.
| Compound Name | 4-ethyl-2,5-bis(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 135742857 |
| Molecular Formula | C10H8F6O |
| Molecular Weight | 258.16 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 4-ethyl-2,5-bis(trifluoromethyl)phenol |
| SMILES | CCc1cc(C(F)(F)F)c(O)cc1C(F)(F)F |
| InChI | InChI=1S/C10H8F6O/c1-2-5-3-7(10(14,15)16)8(17)4-6(5)9(11,12)13/h3-4,17H,2H2,1H3 |
| InChIKey | MAWXJEVVKIAZPB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.16 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |