C9H6F6O2 — CID 119015933
5-(hydroxymethyl)-2,4-bis(trifluoromethyl)phenol (PubChem CID 119015933) has the molecular formula C9H6F6O2 and a molecular weight of 260.13 g/mol. Its IUPAC name is 5-(hydroxymethyl)-2,4-bis(trifluoromethyl)phenol.
| Compound Name | 5-(hydroxymethyl)-2,4-bis(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 119015933 |
| Molecular Formula | C9H6F6O2 |
| Molecular Weight | 260.13 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 5-(hydroxymethyl)-2,4-bis(trifluoromethyl)phenol |
| SMILES | OCc1cc(O)c(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C9H6F6O2/c10-8(11,12)5-2-6(9(13,14)15)7(17)1-4(5)3-16/h1-2,16-17H,3H2 |
| InChIKey | PXIJOXNTHGDYPM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.13 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |