C10H5F6NO — CID 118997715
4-(hydroxymethyl)-2,5-bis(trifluoromethyl)benzonitrile (PubChem CID 118997715) has the molecular formula C10H5F6NO and a molecular weight of 269.14 g/mol. Its IUPAC name is 4-(hydroxymethyl)-2,5-bis(trifluoromethyl)benzonitrile.
| Compound Name | 4-(hydroxymethyl)-2,5-bis(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 118997715 |
| Molecular Formula | C10H5F6NO |
| Molecular Weight | 269.14 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | 4-(hydroxymethyl)-2,5-bis(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1cc(C(F)(F)F)c(CO)cc1C(F)(F)F |
| InChI | InChI=1S/C10H5F6NO/c11-9(12,13)7-2-6(4-18)8(10(14,15)16)1-5(7)3-17/h1-2,18H,4H2 |
| InChIKey | LJUPBFGZZRPKER-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.14 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |