C11H4F6N2 — CID 162523439
4-(cyanomethyl)-2,5-bis(trifluoromethyl)benzonitrile (PubChem CID 162523439) has the molecular formula C11H4F6N2 and a molecular weight of 278.16 g/mol. Its IUPAC name is 4-(cyanomethyl)-2,5-bis(trifluoromethyl)benzonitrile.
| Compound Name | 4-(cyanomethyl)-2,5-bis(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 162523439 |
| Molecular Formula | C11H4F6N2 |
| Molecular Weight | 278.16 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 4-(cyanomethyl)-2,5-bis(trifluoromethyl)benzonitrile |
| SMILES | N#CCc1cc(C(F)(F)F)c(C#N)cc1C(F)(F)F |
| InChI | InChI=1S/C11H4F6N2/c12-10(13,14)8-4-7(5-19)9(11(15,16)17)3-6(8)1-2-18/h3-4H,1H2 |
| InChIKey | BPDVKBZEMIXOMX-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.16 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |