C11H4F3N3 — CID 177068334
2-[4,5-diisocyano-2-(trifluoromethyl)phenyl]acetonitrile (PubChem CID 177068334) has the molecular formula C11H4F3N3 and a molecular weight of 235.17 g/mol. Its IUPAC name is 2-[4,5-diisocyano-2-(trifluoromethyl)phenyl]acetonitrile.
| Compound Name | 2-[4,5-diisocyano-2-(trifluoromethyl)phenyl]acetonitrile |
|---|---|
| PubChem CID | 177068334 |
| Molecular Formula | C11H4F3N3 |
| Molecular Weight | 235.17 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | 2-[4,5-diisocyano-2-(trifluoromethyl)phenyl]acetonitrile |
| SMILES | [C-]#[N+]c1cc(CC#N)c(C(F)(F)F)cc1[N+]#[C-] |
| InChI | InChI=1S/C11H4F3N3/c1-16-9-5-7(3-4-15)8(11(12,13)14)6-10(9)17-2/h5-6H,3H2 |
| InChIKey | ZFBHUAXYYCQFAB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 32.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.17 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|