C10H5F6N — CID 2773227
2-[2,5-bis(trifluoromethyl)phenyl]acetonitrile (PubChem CID 2773227) has the molecular formula C10H5F6N and a molecular weight of 253.15 g/mol. Its IUPAC name is 2-[2,5-bis(trifluoromethyl)phenyl]acetonitrile.
| Compound Name | 2-[2,5-bis(trifluoromethyl)phenyl]acetonitrile |
|---|---|
| PubChem CID | 2773227 |
| Molecular Formula | C10H5F6N |
| Molecular Weight | 253.15 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 2-[2,5-bis(trifluoromethyl)phenyl]acetonitrile |
| SMILES | N#CCc1cc(C(F)(F)F)ccc1C(F)(F)F |
| InChI | InChI=1S/C10H5F6N/c11-9(12,13)7-1-2-8(10(14,15)16)6(5-7)3-4-17/h1-2,5H,3H2 |
| InChIKey | PMNBXHKKVPKJER-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.15 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |