C10H6F6O — CID 53403463
2-[2,5-bis(trifluoromethyl)phenyl]acetaldehyde (PubChem CID 53403463) has the molecular formula C10H6F6O and a molecular weight of 256.14 g/mol. Its IUPAC name is 2-[2,5-bis(trifluoromethyl)phenyl]acetaldehyde.
| Compound Name | 2-[2,5-bis(trifluoromethyl)phenyl]acetaldehyde |
|---|---|
| PubChem CID | 53403463 |
| Molecular Formula | C10H6F6O |
| Molecular Weight | 256.14 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 2-[2,5-bis(trifluoromethyl)phenyl]acetaldehyde |
| SMILES | O=CCc1cc(C(F)(F)F)ccc1C(F)(F)F |
| InChI | InChI=1S/C10H6F6O/c11-9(12,13)7-1-2-8(10(14,15)16)6(5-7)3-4-17/h1-2,4-5H,3H2 |
| InChIKey | VGZYUKBKRUURQG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.14 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|