C23H16Br2F12O — CID 151909059
1,7-bis[2,5-bis(trifluoromethyl)phenyl]-2,6-dibromoheptan-4-one (PubChem CID 151909059) has the molecular formula C23H16Br2F12O and a molecular weight of 696.16 g/mol. Its IUPAC name is 1,7-bis[2,5-bis(trifluoromethyl)phenyl]-2,6-dibromoheptan-4-one.
| Compound Name | 1,7-bis[2,5-bis(trifluoromethyl)phenyl]-2,6-dibromoheptan-4-one |
|---|---|
| PubChem CID | 151909059 |
| Molecular Formula | C23H16Br2F12O |
| Molecular Weight | 696.16 g/mol |
| Exact Mass | 693.94 |
| IUPAC Name | 1,7-bis[2,5-bis(trifluoromethyl)phenyl]-2,6-dibromoheptan-4-one |
| SMILES | O=C(CC(Br)Cc1cc(C(F)(F)F)ccc1C(F)(F)F)CC(Br)Cc1cc(C(F)(F)F)ccc1C(F)(F)F |
| InChI | InChI=1S/C23H16Br2F12O/c24-15(7-11-5-13(20(26,27)28)1-3-18(11)22(32,33)34)9-17(38)10-16(25)8-12-6-14(21(29,30)31)2-4-19(12)23(35,36)37/h1-6,15-16H,7-10H2 |
| InChIKey | SUJCSHYZBUYSPJ-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.16 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|