C13H15Br2F3 — CID 115512253
2-bromo-1-(2-bromo-4-methylpentyl)-4-(trifluoromethyl)benzene (PubChem CID 115512253) has the molecular formula C13H15Br2F3 and a molecular weight of 388.07 g/mol. Its IUPAC name is 2-bromo-1-(2-bromo-4-methylpentyl)-4-(trifluoromethyl)benzene.
| Compound Name | 2-bromo-1-(2-bromo-4-methylpentyl)-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 115512253 |
| Molecular Formula | C13H15Br2F3 |
| Molecular Weight | 388.07 g/mol |
| Exact Mass | 385.95 |
| IUPAC Name | 2-bromo-1-(2-bromo-4-methylpentyl)-4-(trifluoromethyl)benzene |
| SMILES | CC(C)CC(Br)Cc1ccc(C(F)(F)F)cc1Br |
| InChI | InChI=1S/C13H15Br2F3/c1-8(2)5-11(14)6-9-3-4-10(7-12(9)15)13(16,17)18/h3-4,7-8,11H,5-6H2,1-2H3 |
| InChIKey | ISQDLZDSOFXSCQ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.07 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|