C12H15BrF3N — CID 115511441
2-bromo-N-(3-methylbutyl)-4-(trifluoromethyl)aniline (PubChem CID 115511441) has the molecular formula C12H15BrF3N and a molecular weight of 310.16 g/mol. Its IUPAC name is 2-bromo-N-(3-methylbutyl)-4-(trifluoromethyl)aniline.
| Compound Name | 2-bromo-N-(3-methylbutyl)-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 115511441 |
| Molecular Formula | C12H15BrF3N |
| Molecular Weight | 310.16 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | 2-bromo-N-(3-methylbutyl)-4-(trifluoromethyl)aniline |
| SMILES | CC(C)CCNc1ccc(C(F)(F)F)cc1Br |
| InChI | InChI=1S/C12H15BrF3N/c1-8(2)5-6-17-11-4-3-9(7-10(11)13)12(14,15)16/h3-4,7-8,17H,5-6H2,1-2H3 |
| InChIKey | XHRGOYJOBPPDJK-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.16 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |