C15H22BrF3N2 — CID 115511638
N-[2-bromo-4-(trifluoromethyl)phenyl]-N'-methyl-N'-propan-2-ylbutane-1,4-diamine (PubChem CID 115511638) has the molecular formula C15H22BrF3N2 and a molecular weight of 367.25 g/mol. Its IUPAC name is N-[2-bromo-4-(trifluoromethyl)phenyl]-N'-methyl-N'-propan-2-ylbutane-1,4-diamine.
| Compound Name | N-[2-bromo-4-(trifluoromethyl)phenyl]-N'-methyl-N'-propan-2-ylbutane-1,4-diamine |
|---|---|
| PubChem CID | 115511638 |
| Molecular Formula | C15H22BrF3N2 |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | N-[2-bromo-4-(trifluoromethyl)phenyl]-N'-methyl-N'-propan-2-ylbutane-1,4-diamine |
| SMILES | CC(C)N(C)CCCCNc1ccc(C(F)(F)F)cc1Br |
| InChI | InChI=1S/C15H22BrF3N2/c1-11(2)21(3)9-5-4-8-20-14-7-6-12(10-13(14)16)15(17,18)19/h6-7,10-11,20H,4-5,8-9H2,1-3H3 |
| InChIKey | YWYSMANZVIGBGF-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|