C12H13BrF3N — CID 113325985
2-bromo-N-(2-cyclopropylethyl)-4-(trifluoromethyl)aniline (PubChem CID 113325985) has the molecular formula C12H13BrF3N and a molecular weight of 308.14 g/mol. Its IUPAC name is 2-bromo-N-(2-cyclopropylethyl)-4-(trifluoromethyl)aniline.
| Compound Name | 2-bromo-N-(2-cyclopropylethyl)-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 113325985 |
| Molecular Formula | C12H13BrF3N |
| Molecular Weight | 308.14 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 2-bromo-N-(2-cyclopropylethyl)-4-(trifluoromethyl)aniline |
| SMILES | FC(F)(F)c1ccc(NCCC2CC2)c(Br)c1 |
| InChI | InChI=1S/C12H13BrF3N/c13-10-7-9(12(14,15)16)3-4-11(10)17-6-5-8-1-2-8/h3-4,7-8,17H,1-2,5-6H2 |
| InChIKey | ANWGDOQFVBWTDO-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.14 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |