C14H16BrClF3N — CID 106125456
2-bromo-N-[(3-chlorocyclohexyl)methyl]-4-(trifluoromethyl)aniline (PubChem CID 106125456) has the molecular formula C14H16BrClF3N and a molecular weight of 370.64 g/mol. Its IUPAC name is 2-bromo-N-[(3-chlorocyclohexyl)methyl]-4-(trifluoromethyl)aniline.
| Compound Name | 2-bromo-N-[(3-chlorocyclohexyl)methyl]-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 106125456 |
| Molecular Formula | C14H16BrClF3N |
| Molecular Weight | 370.64 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | 2-bromo-N-[(3-chlorocyclohexyl)methyl]-4-(trifluoromethyl)aniline |
| SMILES | FC(F)(F)c1ccc(NCC2CCCC(Cl)C2)c(Br)c1 |
| InChI | InChI=1S/C14H16BrClF3N/c15-12-7-10(14(17,18)19)4-5-13(12)20-8-9-2-1-3-11(16)6-9/h4-5,7,9,11,20H,1-3,6,8H2 |
| InChIKey | WAMIRKPQOVEBSO-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.64 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|