C13H15BrF3N — CID 114108414
2-bromo-N-[(1-methylcyclobutyl)methyl]-4-(trifluoromethyl)aniline (PubChem CID 114108414) has the molecular formula C13H15BrF3N and a molecular weight of 322.17 g/mol. Its IUPAC name is 2-bromo-N-[(1-methylcyclobutyl)methyl]-4-(trifluoromethyl)aniline.
| Compound Name | 2-bromo-N-[(1-methylcyclobutyl)methyl]-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 114108414 |
| Molecular Formula | C13H15BrF3N |
| Molecular Weight | 322.17 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | 2-bromo-N-[(1-methylcyclobutyl)methyl]-4-(trifluoromethyl)aniline |
| SMILES | CC1(CNc2ccc(C(F)(F)F)cc2Br)CCC1 |
| InChI | InChI=1S/C13H15BrF3N/c1-12(5-2-6-12)8-18-11-4-3-9(7-10(11)14)13(15,16)17/h3-4,7,18H,2,5-6,8H2,1H3 |
| InChIKey | KRUQZADANNTJQN-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.17 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |