C14H18F3N3 — CID 62639916
2-[2-[methyl(propan-2-yl)amino]ethylamino]-5-(trifluoromethyl)benzonitrile (PubChem CID 62639916) has the molecular formula C14H18F3N3 and a molecular weight of 285.31 g/mol. Its IUPAC name is 2-[2-[methyl(propan-2-yl)amino]ethylamino]-5-(trifluoromethyl)benzonitrile.
| Compound Name | 2-[2-[methyl(propan-2-yl)amino]ethylamino]-5-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 62639916 |
| Molecular Formula | C14H18F3N3 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 2-[2-[methyl(propan-2-yl)amino]ethylamino]-5-(trifluoromethyl)benzonitrile |
| SMILES | CC(C)N(C)CCNc1ccc(C(F)(F)F)cc1C#N |
| InChI | InChI=1S/C14H18F3N3/c1-10(2)20(3)7-6-19-13-5-4-12(14(15,16)17)8-11(13)9-18/h4-5,8,10,19H,6-7H2,1-3H3 |
| InChIKey | PSVZHERPDIPGLH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |